C20H21NO3 — CID 21309082
(3aR,9bR)-9-methoxy-2-(1-phenylethyl)-1,3,3a,9b-tetrahydrochromeno[3,4-c]pyrrol-4-one (PubChem CID 21309082) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is (3aR,9bR)-9-methoxy-2-(1-phenylethyl)-1,3,3a,9b-tetrahydrochromeno[3,4-c]pyrrol-4-one.
| Compound Name | (3aR,9bR)-9-methoxy-2-(1-phenylethyl)-1,3,3a,9b-tetrahydrochromeno[3,4-c]pyrrol-4-one |
|---|---|
| PubChem CID | 21309082 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (3aR,9bR)-9-methoxy-2-(1-phenylethyl)-1,3,3a,9b-tetrahydrochromeno[3,4-c]pyrrol-4-one |
| SMILES | COc1cccc2c1[C@@H]1CN(C(C)c3ccccc3)C[C@@H]1C(=O)O2 |
| InChI | InChI=1S/C20H21NO3/c1-13(14-7-4-3-5-8-14)21-11-15-16(12-21)20(22)24-18-10-6-9-17(23-2)19(15)18/h3-10,13,15-16H,11-12H2,1-2H3/t13?,15-,16+/m1/s1 |
| InChIKey | TZMOIQRGHJQNJL-CZVYVAOFSA-N |
| XLogP | 3.39 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|