C16H23NO2 — CID 54374242
(3aS,9bR)-2-ethyl-6,7-dimethoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole (PubChem CID 54374242) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is (3aS,9bR)-2-ethyl-6,7-dimethoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole.
| Compound Name | (3aS,9bR)-2-ethyl-6,7-dimethoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole |
|---|---|
| PubChem CID | 54374242 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (3aS,9bR)-2-ethyl-6,7-dimethoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole |
| SMILES | CCN1C[C@H]2CCc3c(ccc(OC)c3OC)[C@@H]2C1 |
| InChI | InChI=1S/C16H23NO2/c1-4-17-9-11-5-6-13-12(14(11)10-17)7-8-15(18-2)16(13)19-3/h7-8,11,14H,4-6,9-10H2,1-3H3/t11-,14-/m1/s1 |
| InChIKey | UVIYYAQNRUMBQS-BXUZGUMPSA-N |
| XLogP | 2.69 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |