About 4-[(5,6-dimethoxy-3,4-dihydro-1H-isochromen-1-yl)methyl]morpholine
4-[(5,6-dimethoxy-3,4-dihydro-1H-isochromen-1-yl)methyl]morpholine (PubChem CID 3053541) has the molecular formula C16H23NO4
and a molecular weight of 293.36 g/mol. Its IUPAC name is 4-[(5,6-dimethoxy-3,4-dihydro-1H-isochromen-1-yl)methyl]morpholine.
Molecular Properties
| Compound Name | 4-[(5,6-dimethoxy-3,4-dihydro-1H-isochromen-1-yl)methyl]morpholine |
| PubChem CID | 3053541 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 4-[(5,6-dimethoxy-3,4-dihydro-1H-isochromen-1-yl)methyl]morpholine |
| SMILES | COc1ccc2c(c1OC)CCOC2CN1CCOCC1 |
| InChI | InChI=1S/C16H23NO4/c1-18-14-4-3-12-13(16(14)19-2)5-8-21-15(12)11-17-6-9-20-10-7-17/h3-4,15H,5-11H2,1-2H3 |
| InChIKey | PSDVQOXQHANDRL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(5,6-dimethoxy-3,4-dihydro-1H-isochromen-1-yl)methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5,6-dimethoxy-3,4-dihydro-1H-isochromen-1-yl)methyl]morpholine?
The IUPAC name of 4-[(5,6-dimethoxy-3,4-dihydro-1H-isochromen-1-yl)methyl]morpholine (CID 3053541) is 4-[(5,6-dimethoxy-3,4-dihydro-1H-isochromen-1-yl)methyl]morpholine.
What is the SMILES notation for 4-[(5,6-dimethoxy-3,4-dihydro-1H-isochromen-1-yl)methyl]morpholine?
The canonical SMILES for 4-[(5,6-dimethoxy-3,4-dihydro-1H-isochromen-1-yl)methyl]morpholine is COc1ccc2c(c1OC)CCOC2CN1CCOCC1.
What is the InChIKey of 4-[(5,6-dimethoxy-3,4-dihydro-1H-isochromen-1-yl)methyl]morpholine?
The InChIKey is PSDVQOXQHANDRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO4/c1-18-14-4-3-12-13(16(14)19-2)5-8-21-15(12)11-17-6-9-20-10-7-17/h3-4,15H,5-11H2,1-2H3.
What are the key properties of 4-[(5,6-dimethoxy-3,4-dihydro-1H-isochromen-1-yl)methyl]morpholine?
4-[(5,6-dimethoxy-3,4-dihydro-1H-isochromen-1-yl)methyl]morpholine has a molecular weight of 293.36 g/mol, XLogP of 1.65, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5,6-dimethoxy-3,4-dihydro-1H-isochromen-1-yl)methyl]morpholine is sourced from PubChem (CID 3053541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).