C20H25NO4 — CID 125438913
(1R)-1-[4-(2,3-dimethoxyphenyl)phenyl]-2-morpholin-4-ylethanol (PubChem CID 125438913) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is (1R)-1-[4-(2,3-dimethoxyphenyl)phenyl]-2-morpholin-4-ylethanol.
| Compound Name | (1R)-1-[4-(2,3-dimethoxyphenyl)phenyl]-2-morpholin-4-ylethanol |
|---|---|
| PubChem CID | 125438913 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | (1R)-1-[4-(2,3-dimethoxyphenyl)phenyl]-2-morpholin-4-ylethanol |
| SMILES | COc1cccc(-c2ccc([C@@H](O)CN3CCOCC3)cc2)c1OC |
| InChI | InChI=1S/C20H25NO4/c1-23-19-5-3-4-17(20(19)24-2)15-6-8-16(9-7-15)18(22)14-21-10-12-25-13-11-21/h3-9,18,22H,10-14H2,1-2H3/t18-/m0/s1 |
| InChIKey | RKEVDPNMCVKPAN-SFHVURJKSA-N |
| XLogP | 2.74 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |