C19H20F3NO3 — CID 126446750
(1R)-2-morpholin-4-yl-1-[4-[3-(trifluoromethoxy)phenyl]phenyl]ethanol (PubChem CID 126446750) has the molecular formula C19H20F3NO3 and a molecular weight of 367.37 g/mol. Its IUPAC name is (1R)-2-morpholin-4-yl-1-[4-[3-(trifluoromethoxy)phenyl]phenyl]ethanol.
| Compound Name | (1R)-2-morpholin-4-yl-1-[4-[3-(trifluoromethoxy)phenyl]phenyl]ethanol |
|---|---|
| PubChem CID | 126446750 |
| Molecular Formula | C19H20F3NO3 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (1R)-2-morpholin-4-yl-1-[4-[3-(trifluoromethoxy)phenyl]phenyl]ethanol |
| SMILES | O[C@@H](CN1CCOCC1)c1ccc(-c2cccc(OC(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C19H20F3NO3/c20-19(21,22)26-17-3-1-2-16(12-17)14-4-6-15(7-5-14)18(24)13-23-8-10-25-11-9-23/h1-7,12,18,24H,8-11,13H2/t18-/m0/s1 |
| InChIKey | JVYNFZOJUDFBTC-SFHVURJKSA-N |
| XLogP | 3.62 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |