C21H27NO4 — CID 126432061
(1S)-1-[4-(2,6-dimethoxy-4-methylphenyl)phenyl]-2-morpholin-4-ylethanol (PubChem CID 126432061) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is (1S)-1-[4-(2,6-dimethoxy-4-methylphenyl)phenyl]-2-morpholin-4-ylethanol.
| Compound Name | (1S)-1-[4-(2,6-dimethoxy-4-methylphenyl)phenyl]-2-morpholin-4-ylethanol |
|---|---|
| PubChem CID | 126432061 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | (1S)-1-[4-(2,6-dimethoxy-4-methylphenyl)phenyl]-2-morpholin-4-ylethanol |
| SMILES | COc1cc(C)cc(OC)c1-c1ccc([C@H](O)CN2CCOCC2)cc1 |
| InChI | InChI=1S/C21H27NO4/c1-15-12-19(24-2)21(20(13-15)25-3)17-6-4-16(5-7-17)18(23)14-22-8-10-26-11-9-22/h4-7,12-13,18,23H,8-11,14H2,1-3H3/t18-/m1/s1 |
| InChIKey | UUQRAPRDLFAADM-GOSISDBHSA-N |
| XLogP | 3.04 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |