C19H20F3NO2 — CID 126444747
(1S)-2-morpholin-4-yl-1-[4-[3-(trifluoromethyl)phenyl]phenyl]ethanol (PubChem CID 126444747) has the molecular formula C19H20F3NO2 and a molecular weight of 351.37 g/mol. Its IUPAC name is (1S)-2-morpholin-4-yl-1-[4-[3-(trifluoromethyl)phenyl]phenyl]ethanol.
| Compound Name | (1S)-2-morpholin-4-yl-1-[4-[3-(trifluoromethyl)phenyl]phenyl]ethanol |
|---|---|
| PubChem CID | 126444747 |
| Molecular Formula | C19H20F3NO2 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | (1S)-2-morpholin-4-yl-1-[4-[3-(trifluoromethyl)phenyl]phenyl]ethanol |
| SMILES | O[C@H](CN1CCOCC1)c1ccc(-c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C19H20F3NO2/c20-19(21,22)17-3-1-2-16(12-17)14-4-6-15(7-5-14)18(24)13-23-8-10-25-11-9-23/h1-7,12,18,24H,8-11,13H2/t18-/m1/s1 |
| InChIKey | SHVLTDCFMFLFEZ-GOSISDBHSA-N |
| XLogP | 3.74 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |