C20H20F7NO2 — CID 142102319
1-[3,5-bis(trifluoromethyl)phenyl]-2-morpholin-4-ylethanol;fluorobenzene (PubChem CID 142102319) has the molecular formula C20H20F7NO2 and a molecular weight of 439.37 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-2-morpholin-4-ylethanol;fluorobenzene.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-2-morpholin-4-ylethanol;fluorobenzene |
|---|---|
| PubChem CID | 142102319 |
| Molecular Formula | C20H20F7NO2 |
| Molecular Weight | 439.37 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-2-morpholin-4-ylethanol;fluorobenzene |
| SMILES | Fc1ccccc1.OC(CN1CCOCC1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H15F6NO2.C6H5F/c15-13(16,17)10-5-9(6-11(7-10)14(18,19)20)12(22)8-21-1-3-23-4-2-21;7-6-4-2-1-3-5-6/h5-7,12,22H,1-4,8H2;1-5H |
| InChIKey | PWXSFZVWCASMES-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.37 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |