C14H18F3NO2 — CID 117242900
3-morpholin-4-yl-2-[3-(trifluoromethyl)phenyl]propan-1-ol (PubChem CID 117242900) has the molecular formula C14H18F3NO2 and a molecular weight of 289.30 g/mol. Its IUPAC name is 3-morpholin-4-yl-2-[3-(trifluoromethyl)phenyl]propan-1-ol.
| Compound Name | 3-morpholin-4-yl-2-[3-(trifluoromethyl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 117242900 |
| Molecular Formula | C14H18F3NO2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 3-morpholin-4-yl-2-[3-(trifluoromethyl)phenyl]propan-1-ol |
| SMILES | OCC(CN1CCOCC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H18F3NO2/c15-14(16,17)13-3-1-2-11(8-13)12(10-19)9-18-4-6-20-7-5-18/h1-3,8,12,19H,4-7,9-10H2 |
| InChIKey | CYLXPSNWPUYOKU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |