C16H18F3NO2 — CID 68571550
5-morpholin-4-yl-5-[3-(trifluoromethyl)phenyl]pent-1-en-3-one (PubChem CID 68571550) has the molecular formula C16H18F3NO2 and a molecular weight of 313.32 g/mol. Its IUPAC name is 5-morpholin-4-yl-5-[3-(trifluoromethyl)phenyl]pent-1-en-3-one.
| Compound Name | 5-morpholin-4-yl-5-[3-(trifluoromethyl)phenyl]pent-1-en-3-one |
|---|---|
| PubChem CID | 68571550 |
| Molecular Formula | C16H18F3NO2 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 5-morpholin-4-yl-5-[3-(trifluoromethyl)phenyl]pent-1-en-3-one |
| SMILES | C=CC(=O)CC(c1cccc(C(F)(F)F)c1)N1CCOCC1 |
| InChI | InChI=1S/C16H18F3NO2/c1-2-14(21)11-15(20-6-8-22-9-7-20)12-4-3-5-13(10-12)16(17,18)19/h2-5,10,15H,1,6-9,11H2 |
| InChIKey | SGPYVKOQGYSFPQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|