C12H17NO4 — CID 12556410
5-(1-hydroxy-2-morpholin-4-ylethyl)benzene-1,3-diol (PubChem CID 12556410) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is 5-(1-hydroxy-2-morpholin-4-ylethyl)benzene-1,3-diol.
| Compound Name | 5-(1-hydroxy-2-morpholin-4-ylethyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 12556410 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 5-(1-hydroxy-2-morpholin-4-ylethyl)benzene-1,3-diol |
| SMILES | Oc1cc(O)cc(C(O)CN2CCOCC2)c1 |
| InChI | InChI=1S/C12H17NO4/c14-10-5-9(6-11(15)7-10)12(16)8-13-1-3-17-4-2-13/h5-7,12,14-16H,1-4,8H2 |
| InChIKey | GKIFHSXRXUIDRO-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |