C20H31NO3 — CID 111476827
1-(3,5-dimethylphenyl)-2-[4-(oxan-4-yloxy)piperidin-1-yl]ethanol (PubChem CID 111476827) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-2-[4-(oxan-4-yloxy)piperidin-1-yl]ethanol.
| Compound Name | 1-(3,5-dimethylphenyl)-2-[4-(oxan-4-yloxy)piperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 111476827 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-2-[4-(oxan-4-yloxy)piperidin-1-yl]ethanol |
| SMILES | Cc1cc(C)cc(C(O)CN2CCC(OC3CCOCC3)CC2)c1 |
| InChI | InChI=1S/C20H31NO3/c1-15-11-16(2)13-17(12-15)20(22)14-21-7-3-18(4-8-21)24-19-5-9-23-10-6-19/h11-13,18-20,22H,3-10,14H2,1-2H3 |
| InChIKey | XRYKPFBWVGVRSD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |