C25H32N2O5 — CID 515405
1-[7-(1-hydroxy-2-morpholin-4-ylethyl)-9H-xanthen-2-yl]-2-morpholin-4-ylethanol (PubChem CID 515405) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is 1-[7-(1-hydroxy-2-morpholin-4-ylethyl)-9H-xanthen-2-yl]-2-morpholin-4-ylethanol.
| Compound Name | 1-[7-(1-hydroxy-2-morpholin-4-ylethyl)-9H-xanthen-2-yl]-2-morpholin-4-ylethanol |
|---|---|
| PubChem CID | 515405 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 1-[7-(1-hydroxy-2-morpholin-4-ylethyl)-9H-xanthen-2-yl]-2-morpholin-4-ylethanol |
| SMILES | OC(CN1CCOCC1)c1ccc2c(c1)Cc1cc(C(O)CN3CCOCC3)ccc1O2 |
| InChI | InChI=1S/C25H32N2O5/c28-22(16-26-5-9-30-10-6-26)18-1-3-24-20(13-18)15-21-14-19(2-4-25(21)32-24)23(29)17-27-7-11-31-12-8-27/h1-4,13-14,22-23,28-29H,5-12,15-17H2 |
| InChIKey | CUEHJUIRMPOHCU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 74.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |