C26H27NO3 — CID 58294457
[(4aR)-7,8-dimethoxy-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-naphthalen-1-ylmethanone (PubChem CID 58294457) has the molecular formula C26H27NO3 and a molecular weight of 401.51 g/mol. Its IUPAC name is [(4aR)-7,8-dimethoxy-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-naphthalen-1-ylmethanone.
| Compound Name | [(4aR)-7,8-dimethoxy-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-naphthalen-1-ylmethanone |
|---|---|
| PubChem CID | 58294457 |
| Molecular Formula | C26H27NO3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | [(4aR)-7,8-dimethoxy-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-naphthalen-1-ylmethanone |
| SMILES | COc1ccc2c(c1OC)CC[C@@H]1C2CCCN1C(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C26H27NO3/c1-29-24-15-13-19-20-11-6-16-27(23(20)14-12-21(19)25(24)30-2)26(28)22-10-5-8-17-7-3-4-9-18(17)22/h3-5,7-10,13,15,20,23H,6,11-12,14,16H2,1-2H3/t20?,23-/m1/s1 |
| InChIKey | WBRBKXDJEFBTPS-GWQXNCQPSA-N |
| XLogP | 5.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |