C18H26N2O3 — CID 110136269
[(3aR,8aR)-1-methyl-2,3,3a,5,6,7,8,8a-octahydropyrrolo[3,2-b]azepin-4-yl]-(2,3-dimethoxyphenyl)methanone (PubChem CID 110136269) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is [(3aR,8aR)-1-methyl-2,3,3a,5,6,7,8,8a-octahydropyrrolo[3,2-b]azepin-4-yl]-(2,3-dimethoxyphenyl)methanone.
| Compound Name | [(3aR,8aR)-1-methyl-2,3,3a,5,6,7,8,8a-octahydropyrrolo[3,2-b]azepin-4-yl]-(2,3-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 110136269 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | [(3aR,8aR)-1-methyl-2,3,3a,5,6,7,8,8a-octahydropyrrolo[3,2-b]azepin-4-yl]-(2,3-dimethoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)N2CCCC[C@@H]3[C@H]2CCN3C)c1OC |
| InChI | InChI=1S/C18H26N2O3/c1-19-12-10-15-14(19)8-4-5-11-20(15)18(21)13-7-6-9-16(22-2)17(13)23-3/h6-7,9,14-15H,4-5,8,10-12H2,1-3H3/t14-,15-/m1/s1 |
| InChIKey | NHSJPUDRAZZWKI-HUUCEWRRSA-N |
| XLogP | 2.40 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |