C26H34N2O4 — CID 92556233
[(5aS,8aS)-7-[(2-methoxy-5-methylphenyl)methyl]-2,3,4,5,5a,6,8,8a-octahydropyrrolo[3,4-b]azepin-1-yl]-(2,3-dimethoxyphenyl)methanone (PubChem CID 92556233) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is [(5aS,8aS)-7-[(2-methoxy-5-methylphenyl)methyl]-2,3,4,5,5a,6,8,8a-octahydropyrrolo[3,4-b]azepin-1-yl]-(2,3-dimethoxyphenyl)methanone.
| Compound Name | [(5aS,8aS)-7-[(2-methoxy-5-methylphenyl)methyl]-2,3,4,5,5a,6,8,8a-octahydropyrrolo[3,4-b]azepin-1-yl]-(2,3-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 92556233 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | [(5aS,8aS)-7-[(2-methoxy-5-methylphenyl)methyl]-2,3,4,5,5a,6,8,8a-octahydropyrrolo[3,4-b]azepin-1-yl]-(2,3-dimethoxyphenyl)methanone |
| SMILES | COc1ccc(C)cc1CN1C[C@@H]2CCCCN(C(=O)c3cccc(OC)c3OC)[C@@H]2C1 |
| InChI | InChI=1S/C26H34N2O4/c1-18-11-12-23(30-2)20(14-18)16-27-15-19-8-5-6-13-28(22(19)17-27)26(29)21-9-7-10-24(31-3)25(21)32-4/h7,9-12,14,19,22H,5-6,8,13,15-17H2,1-4H3/t19-,22+/m0/s1 |
| InChIKey | KTDVZEAVHWIAEQ-SIKLNZKXSA-N |
| XLogP | 4.15 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |