C24H30N4O2S — CID 95858035
1-[(5aS,8aS)-7-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-2,3,4,5,5a,6,8,8a-octahydropyrrolo[3,4-b]azepin-1-yl]-2-(2-methoxyphenyl)ethanone (PubChem CID 95858035) has the molecular formula C24H30N4O2S and a molecular weight of 438.60 g/mol. Its IUPAC name is 1-[(5aS,8aS)-7-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-2,3,4,5,5a,6,8,8a-octahydropyrrolo[3,4-b]azepin-1-yl]-2-(2-methoxyphenyl)ethanone.
| Compound Name | 1-[(5aS,8aS)-7-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-2,3,4,5,5a,6,8,8a-octahydropyrrolo[3,4-b]azepin-1-yl]-2-(2-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 95858035 |
| Molecular Formula | C24H30N4O2S |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 1-[(5aS,8aS)-7-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-2,3,4,5,5a,6,8,8a-octahydropyrrolo[3,4-b]azepin-1-yl]-2-(2-methoxyphenyl)ethanone |
| SMILES | COc1ccccc1CC(=O)N1CCCC[C@H]2CN(Cc3c(C)nc4sccn34)C[C@H]21 |
| InChI | InChI=1S/C24H30N4O2S/c1-17-20(28-11-12-31-24(28)25-17)15-26-14-19-8-5-6-10-27(21(19)16-26)23(29)13-18-7-3-4-9-22(18)30-2/h3-4,7,9,11-12,19,21H,5-6,8,10,13-16H2,1-2H3/t19-,21+/m0/s1 |
| InChIKey | SMJZFOMAMJFVLK-PZJWPPBQSA-N |
| XLogP | 3.77 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |