C23H28N2O5 — CID 7565850
2,3,4-trimethoxy-N-[2-[(2S)-2-methylpiperidine-1-carbonyl]phenyl]benzamide (PubChem CID 7565850) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is 2,3,4-trimethoxy-N-[2-[(2S)-2-methylpiperidine-1-carbonyl]phenyl]benzamide.
| Compound Name | 2,3,4-trimethoxy-N-[2-[(2S)-2-methylpiperidine-1-carbonyl]phenyl]benzamide |
|---|---|
| PubChem CID | 7565850 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 2,3,4-trimethoxy-N-[2-[(2S)-2-methylpiperidine-1-carbonyl]phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2C(=O)N2CCCC[C@@H]2C)c(OC)c1OC |
| InChI | InChI=1S/C23H28N2O5/c1-15-9-7-8-14-25(15)23(27)16-10-5-6-11-18(16)24-22(26)17-12-13-19(28-2)21(30-4)20(17)29-3/h5-6,10-13,15H,7-9,14H2,1-4H3,(H,24,26)/t15-/m0/s1 |
| InChIKey | ZNLOZQFWYMUGDC-HNNXBMFYSA-N |
| XLogP | 3.98 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |