C14H19NO — CID 83887769
7-methoxy-1,2,3,4,4a,5,6,10b-octahydrobenzo[h]quinoline (PubChem CID 83887769) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 7-methoxy-1,2,3,4,4a,5,6,10b-octahydrobenzo[h]quinoline.
| Compound Name | 7-methoxy-1,2,3,4,4a,5,6,10b-octahydrobenzo[h]quinoline |
|---|---|
| PubChem CID | 83887769 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 7-methoxy-1,2,3,4,4a,5,6,10b-octahydrobenzo[h]quinoline |
| SMILES | COc1cccc2c1CCC1CCCNC21 |
| InChI | InChI=1S/C14H19NO/c1-16-13-6-2-5-12-11(13)8-7-10-4-3-9-15-14(10)12/h2,5-6,10,14-15H,3-4,7-9H2,1H3 |
| InChIKey | JBDUWYJDRUQWIY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |