C13H17NO — CID 84733977
1-cyclobutyl-4-methoxy-2,3-dihydro-1H-isoindole (PubChem CID 84733977) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is 1-cyclobutyl-4-methoxy-2,3-dihydro-1H-isoindole.
| Compound Name | 1-cyclobutyl-4-methoxy-2,3-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 84733977 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 1-cyclobutyl-4-methoxy-2,3-dihydro-1H-isoindole |
| SMILES | COc1cccc2c1CNC2C1CCC1 |
| InChI | InChI=1S/C13H17NO/c1-15-12-7-3-6-10-11(12)8-14-13(10)9-4-2-5-9/h3,6-7,9,13-14H,2,4-5,8H2,1H3 |
| InChIKey | FMJPWKRXZCBIKO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |