C24H23ClN4O3S — CID 101432033
11-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-4-chloro-8-thia-3,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-10,12-dione (PubChem CID 101432033) has the molecular formula C24H23ClN4O3S and a molecular weight of 482.99 g/mol. Its IUPAC name is 11-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-4-chloro-8-thia-3,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-10,12-dione.
| Compound Name | 11-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-4-chloro-8-thia-3,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-10,12-dione |
|---|---|
| PubChem CID | 101432033 |
| Molecular Formula | C24H23ClN4O3S |
| Molecular Weight | 482.99 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 11-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-4-chloro-8-thia-3,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-10,12-dione |
| SMILES | COc1cccc2c1CC[C@H]1CN(CCN3C(=O)Cc4c(sc5ncc(Cl)nc45)C3=O)C[C@@H]21 |
| InChI | InChI=1S/C24H23ClN4O3S/c1-32-18-4-2-3-14-15(18)6-5-13-11-28(12-17(13)14)7-8-29-20(30)9-16-21-23(26-10-19(25)27-21)33-22(16)24(29)31/h2-4,10,13,17H,5-9,11-12H2,1H3/t13-,17+/m0/s1 |
| InChIKey | DMNLIQGPJTYFAJ-SUMWQHHRSA-N |
| XLogP | 3.54 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.99 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|