C13H20O2 — CID 156843779
ethane;5-methoxy-4-methyl-3,4-dihydro-2H-chromene (PubChem CID 156843779) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is ethane;5-methoxy-4-methyl-3,4-dihydro-2H-chromene.
| Compound Name | ethane;5-methoxy-4-methyl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 156843779 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | ethane;5-methoxy-4-methyl-3,4-dihydro-2H-chromene |
| SMILES | CC.COc1cccc2c1C(C)CCO2 |
| InChI | InChI=1S/C11H14O2.C2H6/c1-8-6-7-13-10-5-3-4-9(12-2)11(8)10;1-2/h3-5,8H,6-7H2,1-2H3;1-2H3 |
| InChIKey | IITLPETUGWGZQO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |