C13H18N2O — CID 64932917
1-(2,3-dihydro-1-benzofuran-3-yl)-2-methylpiperazine (PubChem CID 64932917) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-3-yl)-2-methylpiperazine.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-3-yl)-2-methylpiperazine |
|---|---|
| PubChem CID | 64932917 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-3-yl)-2-methylpiperazine |
| SMILES | CC1CNCCN1C1COc2ccccc21 |
| InChI | InChI=1S/C13H18N2O/c1-10-8-14-6-7-15(10)12-9-16-13-5-3-2-4-11(12)13/h2-5,10,12,14H,6-9H2,1H3 |
| InChIKey | YTTJRGVDCMBBHI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |