C16H16N2O — CID 21258045
14-oxa-2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),8,10,12,15,17-hexaene (PubChem CID 21258045) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is 14-oxa-2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),8,10,12,15,17-hexaene.
| Compound Name | 14-oxa-2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),8,10,12,15,17-hexaene |
|---|---|
| PubChem CID | 21258045 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 14-oxa-2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),8,10,12,15,17-hexaene |
| SMILES | c1ccc2c(c1)Oc1ccccc1N1CCNCC21 |
| InChI | InChI=1S/C16H16N2O/c1-3-7-15-12(5-1)14-11-17-9-10-18(14)13-6-2-4-8-16(13)19-15/h1-8,14,17H,9-11H2 |
| InChIKey | UVNHOSOCARUDRJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |