C17H16N2O — CID 10515759
8-oxa-1,17-diazapentacyclo[13.5.0.02,7.09,14.016,18]icosa-2,4,6,9,11,13-hexaene (PubChem CID 10515759) has the molecular formula C17H16N2O and a molecular weight of 264.33 g/mol. Its IUPAC name is 8-oxa-1,17-diazapentacyclo[13.5.0.02,7.09,14.016,18]icosa-2,4,6,9,11,13-hexaene.
| Compound Name | 8-oxa-1,17-diazapentacyclo[13.5.0.02,7.09,14.016,18]icosa-2,4,6,9,11,13-hexaene |
|---|---|
| PubChem CID | 10515759 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 8-oxa-1,17-diazapentacyclo[13.5.0.02,7.09,14.016,18]icosa-2,4,6,9,11,13-hexaene |
| SMILES | c1ccc2c(c1)Oc1ccccc1N1CCC3NC3C21 |
| InChI | InChI=1S/C17H16N2O/c1-3-7-14-11(5-1)17-16-12(18-16)9-10-19(17)13-6-2-4-8-15(13)20-14/h1-8,12,16-18H,9-10H2 |
| InChIKey | HZPOGYKPOPWRLD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 34.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|