C8H6O3 — CID 123218550
7-oxabicyclo[4.2.0]octa-1,3,5-trien-8-yl formate (PubChem CID 123218550) has the molecular formula C8H6O3 and a molecular weight of 150.13 g/mol. Its IUPAC name is 7-oxabicyclo[4.2.0]octa-1,3,5-trien-8-yl formate.
| Compound Name | 7-oxabicyclo[4.2.0]octa-1,3,5-trien-8-yl formate |
|---|---|
| PubChem CID | 123218550 |
| Molecular Formula | C8H6O3 |
| Molecular Weight | 150.13 g/mol |
| Exact Mass | 150.03 |
| IUPAC Name | 7-oxabicyclo[4.2.0]octa-1,3,5-trien-8-yl formate |
| SMILES | O=COC1Oc2ccccc21 |
| InChI | InChI=1S/C8H6O3/c9-5-10-8-6-3-1-2-4-7(6)11-8/h1-5,8H |
| InChIKey | AJCBCJWBLBBUBT-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.13 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|