C9H8F2O2 — CID 84660391
2-(2,2-difluoroethyl)-1,3-benzodioxole (PubChem CID 84660391) has the molecular formula C9H8F2O2 and a molecular weight of 186.16 g/mol. Its IUPAC name is 2-(2,2-difluoroethyl)-1,3-benzodioxole.
| Compound Name | 2-(2,2-difluoroethyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 84660391 |
| Molecular Formula | C9H8F2O2 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 2-(2,2-difluoroethyl)-1,3-benzodioxole |
| SMILES | FC(F)CC1Oc2ccccc2O1 |
| InChI | InChI=1S/C9H8F2O2/c10-8(11)5-9-12-6-3-1-2-4-7(6)13-9/h1-4,8-9H,5H2 |
| InChIKey | LTSNJFQFZYECGP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |