C11H12O2 — CID 54477156
2-(3,4-dihydro-2H-chromen-2-yl)acetaldehyde (PubChem CID 54477156) has the molecular formula C11H12O2 and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-chromen-2-yl)acetaldehyde.
| Compound Name | 2-(3,4-dihydro-2H-chromen-2-yl)acetaldehyde |
|---|---|
| PubChem CID | 54477156 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 2-(3,4-dihydro-2H-chromen-2-yl)acetaldehyde |
| SMILES | O=CCC1CCc2ccccc2O1 |
| InChI | InChI=1S/C11H12O2/c12-8-7-10-6-5-9-3-1-2-4-11(9)13-10/h1-4,8,10H,5-7H2 |
| InChIKey | XMJYQJKSLGZLIB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|