C19H24O3 — CID 142231638
benzene;2-(3,4-dihydro-2H-chromen-2-yl)acetaldehyde;ethanol (PubChem CID 142231638) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is benzene;2-(3,4-dihydro-2H-chromen-2-yl)acetaldehyde;ethanol.
| Compound Name | benzene;2-(3,4-dihydro-2H-chromen-2-yl)acetaldehyde;ethanol |
|---|---|
| PubChem CID | 142231638 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | benzene;2-(3,4-dihydro-2H-chromen-2-yl)acetaldehyde;ethanol |
| SMILES | CCO.O=CCC1CCc2ccccc2O1.c1ccccc1 |
| InChI | InChI=1S/C11H12O2.C6H6.C2H6O/c12-8-7-10-6-5-9-3-1-2-4-11(9)13-10;1-2-4-6-5-3-1;1-2-3/h1-4,8,10H,5-7H2;1-6H;3H,2H2,1H3 |
| InChIKey | VLNRMJGTRFXCNF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|