C20H22O2S — CID 73333184
S-(2,4,6-trimethylphenyl) 2-[(2R)-3,4-dihydro-2H-chromen-2-yl]ethanethioate (PubChem CID 73333184) has the molecular formula C20H22O2S and a molecular weight of 326.46 g/mol. Its IUPAC name is S-(2,4,6-trimethylphenyl) 2-[(2R)-3,4-dihydro-2H-chromen-2-yl]ethanethioate.
| Compound Name | S-(2,4,6-trimethylphenyl) 2-[(2R)-3,4-dihydro-2H-chromen-2-yl]ethanethioate |
|---|---|
| PubChem CID | 73333184 |
| Molecular Formula | C20H22O2S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | S-(2,4,6-trimethylphenyl) 2-[(2R)-3,4-dihydro-2H-chromen-2-yl]ethanethioate |
| SMILES | Cc1cc(C)c(SC(=O)C[C@H]2CCc3ccccc3O2)c(C)c1 |
| InChI | InChI=1S/C20H22O2S/c1-13-10-14(2)20(15(3)11-13)23-19(21)12-17-9-8-16-6-4-5-7-18(16)22-17/h4-7,10-11,17H,8-9,12H2,1-3H3/t17-/m1/s1 |
| InChIKey | XZRNEJIJRHJEJZ-QGZVFWFLSA-N |
| XLogP | 5.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|