C24H27NO — CID 66899013
N-benzylethanamine;2-phenyl-3,4-dihydro-2H-chromene (PubChem CID 66899013) has the molecular formula C24H27NO and a molecular weight of 345.49 g/mol. Its IUPAC name is N-benzylethanamine;2-phenyl-3,4-dihydro-2H-chromene.
| Compound Name | N-benzylethanamine;2-phenyl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 66899013 |
| Molecular Formula | C24H27NO |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | N-benzylethanamine;2-phenyl-3,4-dihydro-2H-chromene |
| SMILES | CCNCc1ccccc1.c1ccc(C2CCc3ccccc3O2)cc1 |
| InChI | InChI=1S/C15H14O.C9H13N/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15;1-2-10-8-9-6-4-3-5-7-9/h1-9,15H,10-11H2;3-7,10H,2,8H2,1H3 |
| InChIKey | FCTVOVNDMQXWCW-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |