C14H13NO2 — CID 57215409
4-(3,4-dihydro-2H-chromen-2-yl)-1-oxidopyridin-1-ium (PubChem CID 57215409) has the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-chromen-2-yl)-1-oxidopyridin-1-ium.
| Compound Name | 4-(3,4-dihydro-2H-chromen-2-yl)-1-oxidopyridin-1-ium |
|---|---|
| PubChem CID | 57215409 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 4-(3,4-dihydro-2H-chromen-2-yl)-1-oxidopyridin-1-ium |
| SMILES | [O-][n+]1ccc(C2CCc3ccccc3O2)cc1 |
| InChI | InChI=1S/C14H13NO2/c16-15-9-7-12(8-10-15)14-6-5-11-3-1-2-4-13(11)17-14/h1-4,7-10,14H,5-6H2 |
| InChIKey | JKDBQRDEYRAZEY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 36.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|