C18H18O2 — CID 173011896
2-(3,4-dihydro-2H-chromen-6-yl)-3,4-dihydro-2H-chromene (PubChem CID 173011896) has the molecular formula C18H18O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-chromen-6-yl)-3,4-dihydro-2H-chromene.
| Compound Name | 2-(3,4-dihydro-2H-chromen-6-yl)-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 173011896 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-(3,4-dihydro-2H-chromen-6-yl)-3,4-dihydro-2H-chromene |
| SMILES | c1ccc2c(c1)CCC(c1ccc3c(c1)CCCO3)O2 |
| InChI | InChI=1S/C18H18O2/c1-2-6-17-13(4-1)7-10-18(20-17)15-8-9-16-14(12-15)5-3-11-19-16/h1-2,4,6,8-9,12,18H,3,5,7,10-11H2 |
| InChIKey | XEFMETHLJHTPHI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |