C18H19NO — CID 123488920
3-(3,4-dihydro-2H-chromen-6-yl)-1,2,3,4-tetrahydroisoquinoline (PubChem CID 123488920) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-chromen-6-yl)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 3-(3,4-dihydro-2H-chromen-6-yl)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 123488920 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 3-(3,4-dihydro-2H-chromen-6-yl)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | c1ccc2c(c1)CNC(c1ccc3c(c1)CCCO3)C2 |
| InChI | InChI=1S/C18H19NO/c1-2-5-16-12-19-17(11-13(16)4-1)14-7-8-18-15(10-14)6-3-9-20-18/h1-2,4-5,7-8,10,17,19H,3,6,9,11-12H2 |
| InChIKey | AQHPITCLVHFDHT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |