C15H14IO+ — CID 16658319
3,4-dihydro-2H-chromen-6-yl(phenyl)iodanium (PubChem CID 16658319) has the molecular formula C15H14IO+ and a molecular weight of 337.18 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-6-yl(phenyl)iodanium.
| Compound Name | 3,4-dihydro-2H-chromen-6-yl(phenyl)iodanium |
|---|---|
| PubChem CID | 16658319 |
| Molecular Formula | C15H14IO+ |
| Molecular Weight | 337.18 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | 3,4-dihydro-2H-chromen-6-yl(phenyl)iodanium |
| SMILES | c1ccc([I+]c2ccc3c(c2)CCCO3)cc1 |
| InChI | InChI=1S/C15H14IO/c1-2-6-13(7-3-1)16-14-8-9-15-12(11-14)5-4-10-17-15/h1-3,6-9,11H,4-5,10H2/q+1 |
| InChIKey | GLWTUWIIXXTSLL-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.18 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|