C11H12F2O2 — CID 163222414
2-(difluoromethoxymethyl)-3,4-dihydro-2H-chromene (PubChem CID 163222414) has the molecular formula C11H12F2O2 and a molecular weight of 214.21 g/mol. Its IUPAC name is 2-(difluoromethoxymethyl)-3,4-dihydro-2H-chromene.
| Compound Name | 2-(difluoromethoxymethyl)-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 163222414 |
| Molecular Formula | C11H12F2O2 |
| Molecular Weight | 214.21 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2-(difluoromethoxymethyl)-3,4-dihydro-2H-chromene |
| SMILES | FC(F)OCC1CCc2ccccc2O1 |
| InChI | InChI=1S/C11H12F2O2/c12-11(13)14-7-9-6-5-8-3-1-2-4-10(8)15-9/h1-4,9,11H,5-7H2 |
| InChIKey | ZEUFXKJKGXDDJI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.21 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |