C10H10O5S — CID 174331709
4-formyl-3,4-dihydro-2H-chromene-2-sulfonic acid (PubChem CID 174331709) has the molecular formula C10H10O5S and a molecular weight of 242.25 g/mol. Its IUPAC name is 4-formyl-3,4-dihydro-2H-chromene-2-sulfonic acid.
| Compound Name | 4-formyl-3,4-dihydro-2H-chromene-2-sulfonic acid |
|---|---|
| PubChem CID | 174331709 |
| Molecular Formula | C10H10O5S |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | 4-formyl-3,4-dihydro-2H-chromene-2-sulfonic acid |
| SMILES | O=CC1CC(S(=O)(=O)O)Oc2ccccc21 |
| InChI | InChI=1S/C10H10O5S/c11-6-7-5-10(16(12,13)14)15-9-4-2-1-3-8(7)9/h1-4,6-7,10H,5H2,(H,12,13,14) |
| InChIKey | RADBAONKAIVFAC-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|