C11H8O3 — CID 10702758
1-methylidene-3a,8b-dihydrofuro[2,3-b][1]benzofuran-2-one (PubChem CID 10702758) has the molecular formula C11H8O3 and a molecular weight of 188.18 g/mol. Its IUPAC name is 1-methylidene-3a,8b-dihydrofuro[2,3-b][1]benzofuran-2-one.
| Compound Name | 1-methylidene-3a,8b-dihydrofuro[2,3-b][1]benzofuran-2-one |
|---|---|
| PubChem CID | 10702758 |
| Molecular Formula | C11H8O3 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | 1-methylidene-3a,8b-dihydrofuro[2,3-b][1]benzofuran-2-one |
| SMILES | C=C1C(=O)OC2Oc3ccccc3C12 |
| InChI | InChI=1S/C11H8O3/c1-6-9-7-4-2-3-5-8(7)13-11(9)14-10(6)12/h2-5,9,11H,1H2 |
| InChIKey | ZXRGSJODNGAUNX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|