C16H11ClO3 — CID 10424132
4-(5-chloro-6-oxocyclohexa-2,4-dien-1-yl)-3-methylidene-4H-chromen-2-one (PubChem CID 10424132) has the molecular formula C16H11ClO3 and a molecular weight of 286.71 g/mol. Its IUPAC name is 4-(5-chloro-6-oxocyclohexa-2,4-dien-1-yl)-3-methylidene-4H-chromen-2-one.
| Compound Name | 4-(5-chloro-6-oxocyclohexa-2,4-dien-1-yl)-3-methylidene-4H-chromen-2-one |
|---|---|
| PubChem CID | 10424132 |
| Molecular Formula | C16H11ClO3 |
| Molecular Weight | 286.71 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 4-(5-chloro-6-oxocyclohexa-2,4-dien-1-yl)-3-methylidene-4H-chromen-2-one |
| SMILES | C=C1C(=O)Oc2ccccc2C1C1C=CC=C(Cl)C1=O |
| InChI | InChI=1S/C16H11ClO3/c1-9-14(11-6-4-7-12(17)15(11)18)10-5-2-3-8-13(10)20-16(9)19/h2-8,11,14H,1H2 |
| InChIKey | GKLGKMYFHXOJGO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.71 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|