C27H18ClN3O — CID 163847764
2-(7-chloro-1,9b-dihydrodibenzofuran-1-yl)-4,6-diphenyl-1,3,5-triazine (PubChem CID 163847764) has the molecular formula C27H18ClN3O and a molecular weight of 435.91 g/mol. Its IUPAC name is 2-(7-chloro-1,9b-dihydrodibenzofuran-1-yl)-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-(7-chloro-1,9b-dihydrodibenzofuran-1-yl)-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 163847764 |
| Molecular Formula | C27H18ClN3O |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 2-(7-chloro-1,9b-dihydrodibenzofuran-1-yl)-4,6-diphenyl-1,3,5-triazine |
| SMILES | Clc1ccc2c(c1)OC1=CC=CC(c3nc(-c4ccccc4)nc(-c4ccccc4)n3)C12 |
| InChI | InChI=1S/C27H18ClN3O/c28-19-14-15-20-23(16-19)32-22-13-7-12-21(24(20)22)27-30-25(17-8-3-1-4-9-17)29-26(31-27)18-10-5-2-6-11-18/h1-16,21,24H |
| InChIKey | ORQTZHBRFBTMJA-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |