C42H27ClN6 — CID 177250533
2-[3-[4-chloro-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 177250533) has the molecular formula C42H27ClN6 and a molecular weight of 651.17 g/mol. Its IUPAC name is 2-[3-[4-chloro-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-[4-chloro-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 177250533 |
| Molecular Formula | C42H27ClN6 |
| Molecular Weight | 651.17 g/mol |
| Exact Mass | 650.20 |
| IUPAC Name | 2-[3-[4-chloro-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | Clc1ccc(-c2cccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)c(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C42H27ClN6/c43-34-24-25-35(36(27-34)42-48-39(30-18-9-3-10-19-30)45-40(49-42)31-20-11-4-12-21-31)32-22-13-23-33(26-32)41-46-37(28-14-5-1-6-15-28)44-38(47-41)29-16-7-2-8-17-29/h1-27H |
| InChIKey | XUBGWGBHHARWET-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.17 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |