C37H24ClN3 — CID 155450368
2-(4-chloro-2-phenylphenyl)-4-(4-naphthalen-1-ylphenyl)-6-phenyl-1,3,5-triazine (PubChem CID 155450368) has the molecular formula C37H24ClN3 and a molecular weight of 546.07 g/mol. Its IUPAC name is 2-(4-chloro-2-phenylphenyl)-4-(4-naphthalen-1-ylphenyl)-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(4-chloro-2-phenylphenyl)-4-(4-naphthalen-1-ylphenyl)-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 155450368 |
| Molecular Formula | C37H24ClN3 |
| Molecular Weight | 546.07 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | 2-(4-chloro-2-phenylphenyl)-4-(4-naphthalen-1-ylphenyl)-6-phenyl-1,3,5-triazine |
| SMILES | Clc1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4cccc5ccccc45)cc3)n2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C37H24ClN3/c38-30-22-23-33(34(24-30)26-10-3-1-4-11-26)37-40-35(28-13-5-2-6-14-28)39-36(41-37)29-20-18-27(19-21-29)32-17-9-15-25-12-7-8-16-31(25)32/h1-24H |
| InChIKey | LHMCNWDYRXVBEV-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.07 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |