C14H12 — CID 95564771
(1S,8R)-13-methylidenetricyclo[6.4.1.02,7]trideca-2,4,6,9,11-pentaene (PubChem CID 95564771) has the molecular formula C14H12 and a molecular weight of 180.25 g/mol. Its IUPAC name is (1S,8R)-13-methylidenetricyclo[6.4.1.02,7]trideca-2,4,6,9,11-pentaene.
| Compound Name | (1S,8R)-13-methylidenetricyclo[6.4.1.02,7]trideca-2,4,6,9,11-pentaene |
|---|---|
| PubChem CID | 95564771 |
| Molecular Formula | C14H12 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | (1S,8R)-13-methylidenetricyclo[6.4.1.02,7]trideca-2,4,6,9,11-pentaene |
| SMILES | C=C1[C@H]2C=CC=C[C@@H]1c1ccccc12 |
| InChI | InChI=1S/C14H12/c1-10-11-6-2-3-7-12(10)14-9-5-4-8-13(11)14/h2-9,11-12H,1H2/t11-,12+ |
| InChIKey | KMFMGAXQPKNXGP-TXEJJXNPSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|