About tricyclo[6.4.1.02,7]trideca-2,4,6,9,11-pentaen-13-one
tricyclo[6.4.1.02,7]trideca-2,4,6,9,11-pentaen-13-one (PubChem CID 101227628) has the molecular formula C13H10O
and a molecular weight of 182.22 g/mol. Its IUPAC name is tricyclo[6.4.1.02,7]trideca-2,4,6,9,11-pentaen-13-one.
Analyze tricyclo[6.4.1.02,7]trideca-2,4,6,9,11-pentaen-13-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[6.4.1.02,7]trideca-2,4,6,9,11-pentaen-13-one?
The IUPAC name of tricyclo[6.4.1.02,7]trideca-2,4,6,9,11-pentaen-13-one (CID 101227628) is tricyclo[6.4.1.02,7]trideca-2,4,6,9,11-pentaen-13-one.
What is the SMILES notation for tricyclo[6.4.1.02,7]trideca-2,4,6,9,11-pentaen-13-one?
The canonical SMILES for tricyclo[6.4.1.02,7]trideca-2,4,6,9,11-pentaen-13-one is O=C1C2C=CC=CC1c1ccccc12.
What is the InChIKey of tricyclo[6.4.1.02,7]trideca-2,4,6,9,11-pentaen-13-one?
The InChIKey is IWBKANUXLBKVII-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O/c14-13-11-7-3-4-8-12(13)10-6-2-1-5-9(10)11/h1-8,11-12H.
What are the key properties of tricyclo[6.4.1.02,7]trideca-2,4,6,9,11-pentaen-13-one?
tricyclo[6.4.1.02,7]trideca-2,4,6,9,11-pentaen-13-one has a molecular weight of 182.22 g/mol, XLogP of 2.56, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[6.4.1.02,7]trideca-2,4,6,9,11-pentaen-13-one is sourced from PubChem (CID 101227628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).