C23H18Si — CID 137296078
4,4-diphenyl-8bH-cyclopenta[b][1]benzosilole (PubChem CID 137296078) has the molecular formula C23H18Si and a molecular weight of 322.48 g/mol. Its IUPAC name is 4,4-diphenyl-8bH-cyclopenta[b][1]benzosilole.
| Compound Name | 4,4-diphenyl-8bH-cyclopenta[b][1]benzosilole |
|---|---|
| PubChem CID | 137296078 |
| Molecular Formula | C23H18Si |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 4,4-diphenyl-8bH-cyclopenta[b][1]benzosilole |
| SMILES | C1=CC2C(=C1)[Si](c1ccccc1)(c1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C23H18Si/c1-3-10-18(11-4-1)24(19-12-5-2-6-13-19)22-16-8-7-14-20(22)21-15-9-17-23(21)24/h1-17,21H |
| InChIKey | DLTXUZRHFUPYKP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|