About 2-(2-methylcyclopenta-2,4-dien-1-yl)benzaldehyde
2-(2-methylcyclopenta-2,4-dien-1-yl)benzaldehyde (PubChem CID 154426433) has the molecular formula C13H12O
and a molecular weight of 184.24 g/mol. Its IUPAC name is 2-(2-methylcyclopenta-2,4-dien-1-yl)benzaldehyde.
Molecular Properties
| Compound Name | 2-(2-methylcyclopenta-2,4-dien-1-yl)benzaldehyde |
| PubChem CID | 154426433 |
| Molecular Formula | C13H12O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 2-(2-methylcyclopenta-2,4-dien-1-yl)benzaldehyde |
| SMILES | CC1=CC=CC1c1ccccc1C=O |
| InChI | InChI=1S/C13H12O/c1-10-5-4-8-12(10)13-7-3-2-6-11(13)9-14/h2-9,12H,1H3 |
| InChIKey | AACONLVFKZNVHP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methylcyclopenta-2,4-dien-1-yl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylcyclopenta-2,4-dien-1-yl)benzaldehyde?
The IUPAC name of 2-(2-methylcyclopenta-2,4-dien-1-yl)benzaldehyde (CID 154426433) is 2-(2-methylcyclopenta-2,4-dien-1-yl)benzaldehyde.
What is the SMILES notation for 2-(2-methylcyclopenta-2,4-dien-1-yl)benzaldehyde?
The canonical SMILES for 2-(2-methylcyclopenta-2,4-dien-1-yl)benzaldehyde is CC1=CC=CC1c1ccccc1C=O.
What is the InChIKey of 2-(2-methylcyclopenta-2,4-dien-1-yl)benzaldehyde?
The InChIKey is AACONLVFKZNVHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O/c1-10-5-4-8-12(10)13-7-3-2-6-11(13)9-14/h2-9,12H,1H3.
What are the key properties of 2-(2-methylcyclopenta-2,4-dien-1-yl)benzaldehyde?
2-(2-methylcyclopenta-2,4-dien-1-yl)benzaldehyde has a molecular weight of 184.24 g/mol, XLogP of 3.10, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylcyclopenta-2,4-dien-1-yl)benzaldehyde is sourced from PubChem (CID 154426433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).