C10H10O4 — CID 134937460
2-(5-methyl-1,2,4-trioxolan-3-yl)benzaldehyde (PubChem CID 134937460) has the molecular formula C10H10O4 and a molecular weight of 194.19 g/mol. Its IUPAC name is 2-(5-methyl-1,2,4-trioxolan-3-yl)benzaldehyde.
| Compound Name | 2-(5-methyl-1,2,4-trioxolan-3-yl)benzaldehyde |
|---|---|
| PubChem CID | 134937460 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 2-(5-methyl-1,2,4-trioxolan-3-yl)benzaldehyde |
| SMILES | CC1OOC(c2ccccc2C=O)O1 |
| InChI | InChI=1S/C10H10O4/c1-7-12-10(14-13-7)9-5-3-2-4-8(9)6-11/h2-7,10H,1H3 |
| InChIKey | LWZGOGIMNNKODE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|