C10H7NO4 — CID 134986787
5-(2-formylphenyl)-1,2,4-trioxolane-3-carbonitrile (PubChem CID 134986787) has the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. Its IUPAC name is 5-(2-formylphenyl)-1,2,4-trioxolane-3-carbonitrile.
| Compound Name | 5-(2-formylphenyl)-1,2,4-trioxolane-3-carbonitrile |
|---|---|
| PubChem CID | 134986787 |
| Molecular Formula | C10H7NO4 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 5-(2-formylphenyl)-1,2,4-trioxolane-3-carbonitrile |
| SMILES | N#CC1OOC(c2ccccc2C=O)O1 |
| InChI | InChI=1S/C10H7NO4/c11-5-9-13-10(15-14-9)8-4-2-1-3-7(8)6-12/h1-4,6,9-10H |
| InChIKey | QMJCMDZSHPNORV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|