C24H20O2Si2 — CID 15436049
2,2,4,4-tetraphenyl-1,3,2,4-dioxadisiletane (PubChem CID 15436049) has the molecular formula C24H20O2Si2 and a molecular weight of 396.59 g/mol. Its IUPAC name is 2,2,4,4-tetraphenyl-1,3,2,4-dioxadisiletane.
| Compound Name | 2,2,4,4-tetraphenyl-1,3,2,4-dioxadisiletane |
|---|---|
| PubChem CID | 15436049 |
| Molecular Formula | C24H20O2Si2 |
| Molecular Weight | 396.59 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 2,2,4,4-tetraphenyl-1,3,2,4-dioxadisiletane |
| SMILES | c1ccc([Si]2(c3ccccc3)O[Si](c3ccccc3)(c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C24H20O2Si2/c1-5-13-21(14-6-1)27(22-15-7-2-8-16-22)25-28(26-27,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20H |
| InChIKey | HBCMWZYBDAGGHP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.59 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|