C36H29ClO3Si3 — CID 154117208
2-(2-chlorophenyl)-2,4,4,6,6-pentakis-phenyl-1,3,5,2,4,6-trioxatrisilinane (PubChem CID 154117208) has the molecular formula C36H29ClO3Si3 and a molecular weight of 629.34 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-2,4,4,6,6-pentakis-phenyl-1,3,5,2,4,6-trioxatrisilinane.
| Compound Name | 2-(2-chlorophenyl)-2,4,4,6,6-pentakis-phenyl-1,3,5,2,4,6-trioxatrisilinane |
|---|---|
| PubChem CID | 154117208 |
| Molecular Formula | C36H29ClO3Si3 |
| Molecular Weight | 629.34 g/mol |
| Exact Mass | 628.11 |
| IUPAC Name | 2-(2-chlorophenyl)-2,4,4,6,6-pentakis-phenyl-1,3,5,2,4,6-trioxatrisilinane |
| SMILES | Clc1ccccc1[Si]1(c2ccccc2)O[Si](c2ccccc2)(c2ccccc2)O[Si](c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C36H29ClO3Si3/c37-35-28-16-17-29-36(35)43(34-26-14-5-15-27-34)39-41(30-18-6-1-7-19-30,31-20-8-2-9-21-31)38-42(40-43,32-22-10-3-11-23-32)33-24-12-4-13-25-33/h1-29H |
| InChIKey | JTHNTYOVAAUMKA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.34 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|